C36H45F9O5 — CID 10123024
11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid (PubChem CID 10123024) has the molecular formula C36H45F9O5 and a molecular weight of 728.73 g/mol. Its IUPAC name is 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid.
| Compound Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid |
|---|---|
| PubChem CID | 10123024 |
| Molecular Formula | C36H45F9O5 |
| Molecular Weight | 728.73 g/mol |
| Exact Mass | 728.31 |
| IUPAC Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)undecanoic acid |
| SMILES | CCCC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCCC(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C36H45F9O5/c1-2-20-32(25-14-16-26(46)17-15-25)23-50-30-22-27(47)18-19-28(30)29(32)13-9-7-5-3-4-6-8-11-24(31(48)49)12-10-21-33(37,38)34(39,40)35(41,42)36(43,44)45/h14-19,22,24,29,46-47H,2-13,20-21,23H2,1H3,(H,48,49) |
| InChIKey | VGFQWVIVOXRQDM-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.73 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|