About (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine
(2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine (PubChem CID 101230525) has the molecular formula C30H29NO
and a molecular weight of 419.57 g/mol. Its IUPAC name is (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine.
Molecular Properties
| Compound Name | (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine |
| PubChem CID | 101230525 |
| Molecular Formula | C30H29NO |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine |
| SMILES | c1ccc(C(O[C@@H]2CCN(c3ccccc3)[C@H](c3ccccc3)C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29NO/c1-5-13-24(14-6-1)29-23-28(21-22-31(29)27-19-11-4-12-20-27)32-30(25-15-7-2-8-16-25)26-17-9-3-10-18-26/h1-20,28-30H,21-23H2/t28-,29+/m1/s1 |
| InChIKey | ILDWELVCCUZQLD-WDYNHAJCSA-N |
| XLogP | 7.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine?
The IUPAC name of (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine (CID 101230525) is (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine.
What is the SMILES notation for (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine?
The canonical SMILES for (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine is c1ccc(C(O[C@@H]2CCN(c3ccccc3)[C@H](c3ccccc3)C2)c2ccccc2)cc1.
What is the InChIKey of (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine?
The InChIKey is ILDWELVCCUZQLD-WDYNHAJCSA-N. The full InChI is InChI=1S/C30H29NO/c1-5-13-24(14-6-1)29-23-28(21-22-31(29)27-19-11-4-12-20-27)32-30(25-15-7-2-8-16-25)26-17-9-3-10-18-26/h1-20,28-30H,21-23H2/t28-,29+/m1/s1.
What are the key properties of (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine?
(2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine has a molecular weight of 419.57 g/mol, XLogP of 7.20, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-4-benzhydryloxy-1,2-diphenylpiperidine is sourced from PubChem (CID 101230525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).