C16H21NO2 — CID 101230926
methyl (5aR,10aR)-5,5a,6,7,8,9,10,11-octahydrocyclohepta[b]quinoline-10a-carboxylate (PubChem CID 101230926) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is methyl (5aR,10aR)-5,5a,6,7,8,9,10,11-octahydrocyclohepta[b]quinoline-10a-carboxylate.
| Compound Name | methyl (5aR,10aR)-5,5a,6,7,8,9,10,11-octahydrocyclohepta[b]quinoline-10a-carboxylate |
|---|---|
| PubChem CID | 101230926 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | methyl (5aR,10aR)-5,5a,6,7,8,9,10,11-octahydrocyclohepta[b]quinoline-10a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCCC[C@H]1Nc1ccccc1C2 |
| InChI | InChI=1S/C16H21NO2/c1-19-15(18)16-10-6-2-3-9-14(16)17-13-8-5-4-7-12(13)11-16/h4-5,7-8,14,17H,2-3,6,9-11H2,1H3/t14-,16-/m1/s1 |
| InChIKey | NHRPJUYLWOAYJR-GDBMZVCRSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |