C14H23NO3 — CID 101231184
2-hex-5-enyl-1-morpholin-4-ylbutane-1,3-dione (PubChem CID 101231184) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2-hex-5-enyl-1-morpholin-4-ylbutane-1,3-dione.
| Compound Name | 2-hex-5-enyl-1-morpholin-4-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 101231184 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2-hex-5-enyl-1-morpholin-4-ylbutane-1,3-dione |
| SMILES | C=CCCCCC(C(C)=O)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C14H23NO3/c1-3-4-5-6-7-13(12(2)16)14(17)15-8-10-18-11-9-15/h3,13H,1,4-11H2,2H3 |
| InChIKey | WRZNRQQUDCSJNF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|