About (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile
(2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile (PubChem CID 101231803) has the molecular formula C6H3F3N2
and a molecular weight of 160.10 g/mol. Its IUPAC name is (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile.
Molecular Properties
| Compound Name | (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile |
| PubChem CID | 101231803 |
| Molecular Formula | C6H3F3N2 |
| Molecular Weight | 160.10 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile |
| SMILES | N#CC1(C#N)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C6H3F3N2/c7-6(8,9)4-1-5(4,2-10)3-11/h4H,1H2/t4-/m0/s1 |
| InChIKey | DCUDHDPAPMEBQR-BYPYZUCNSA-N |
| XLogP | 1.60 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile?
The IUPAC name of (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile (CID 101231803) is (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile.
What is the SMILES notation for (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile?
The canonical SMILES for (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile is N#CC1(C#N)C[C@@H]1C(F)(F)F.
What is the InChIKey of (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile?
The InChIKey is DCUDHDPAPMEBQR-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H3F3N2/c7-6(8,9)4-1-5(4,2-10)3-11/h4H,1H2/t4-/m0/s1.
What are the key properties of (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile?
(2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile has a molecular weight of 160.10 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(trifluoromethyl)cyclopropane-1,1-dicarbonitrile is sourced from PubChem (CID 101231803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).