C20H26N4O2 — CID 101232007
6-[4-(dimethylamino)phenyl]-1,3-dipropyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 101232007) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-1,3-dipropyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-[4-(dimethylamino)phenyl]-1,3-dipropyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101232007 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-1,3-dipropyl-5H-pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCCn1c(=O)c2[nH]c(-c3ccc(N(C)C)cc3)cc2n(CCC)c1=O |
| InChI | InChI=1S/C20H26N4O2/c1-5-11-23-17-13-16(14-7-9-15(10-8-14)22(3)4)21-18(17)19(25)24(12-6-2)20(23)26/h7-10,13,21H,5-6,11-12H2,1-4H3 |
| InChIKey | QPNMJZMDLKVTOJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 63.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|