About CID 101232196
CID 101232196 (PubChem CID 101232196) has the molecular formula C84H64N8O14
and a molecular weight of 1409.48 g/mol.
Molecular Properties
| Compound Name | CID 101232196 |
| PubChem CID | 101232196 |
| Molecular Formula | C84H64N8O14 |
| Molecular Weight | 1409.48 g/mol |
| Exact Mass | 1408.45 |
| IUPAC Name | — |
| SMILES | O=C1N2Cc3cc4c5cc3CN3C(=O)N6Cc7cc8c(cc7CN1C6(c1ccccc1)C23c1ccccc1)OCCOc1cccc(O)c1-c1c2nc(c(c3ccc([nH]3)c(c3nc(c(c6ccc1[nH]6)-c1c(O)cccc1OCCO5)C=C3)-c1c(O)cccc1OCCO4)-c1c(O)cccc1OCCO8)C=C2 |
| InChI | InChI=1S/C84H64N8O14/c93-61-15-7-19-65-77(61)73-53-23-24-54(85-53)74-58-28-30-60(88-58)76-56-26-25-55(86-56)75(59-29-27-57(73)87-59)79-63(95)17-9-21-67(79)101-33-37-105-71-42-50-46-92-82(98)90-44-48-40-70(104-36-32-100-66-20-8-16-62(94)78(66)74)69(103-35-31-99-65)39-47(48)43-89-81(97)91(45-49(50)41-72(71)106-38-34-102-68-22-10-18-64(96)80(68)76)84(92,52-13-5-2-6-14-52)83(89,90)51-11-3-1-4-12-51/h1-30,39-42,87-88,93-96H,31-38,43-46H2/b73-53-,73-57+,74-54+,74-58+,75-55+,75-59+,76-56+,76-60- |
| InChIKey | IOOBKGVXJLAJCE-KBBGOUQHSA-N |
| XLogP | 14.83 |
| TPSA | 259.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 106 |
| Complexity | — |
Lipinski Rule of Five
4 violations
| Rule | Value |
| MW ≤ 500 | 1409.48 |
| LogP ≤ 5 | 14.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
Analyze CID 101232196 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101232196?
The IUPAC name of CID 101232196 (CID 101232196) is not available.
What is the SMILES notation for CID 101232196?
The canonical SMILES for CID 101232196 is O=C1N2Cc3cc4c5cc3CN3C(=O)N6Cc7cc8c(cc7CN1C6(c1ccccc1)C23c1ccccc1)OCCOc1cccc(O)c1-c1c2nc(c(c3ccc([nH]3)c(c3nc(c(c6ccc1[nH]6)-c1c(O)cccc1OCCO5)C=C3)-c1c(O)cccc1OCCO4)-c1c(O)cccc1OCCO8)C=C2.
What is the InChIKey of CID 101232196?
The InChIKey is IOOBKGVXJLAJCE-KBBGOUQHSA-N. The full InChI is InChI=1S/C84H64N8O14/c93-61-15-7-19-65-77(61)73-53-23-24-54(85-53)74-58-28-30-60(88-58)76-56-26-25-55(86-56)75(59-29-27-57(73)87-59)79-63(95)17-9-21-67(79)101-33-37-105-71-42-50-46-92-82(98)90-44-48-40-70(104-36-32-100-66-20-8-16-62(94)78(66)74)69(103-35-31-99-65)39-47(48)43-89-81(97)91(45-49(50)41-72(71)106-38-34-102-68-22-10-18-64(96)80(68)76)84(92,52-13-5-2-6-14-52)83(89,90)51-11-3-1-4-12-51/h1-30,39-42,87-88,93-96H,31-38,43-46H2/b73-53-,73-57+,74-54+,74-58+,75-55+,75-59+,76-56+,76-60-.
What are the key properties of CID 101232196?
CID 101232196 has a molecular weight of 1409.48 g/mol, XLogP of 14.83, 2 rotatable bonds, 6 hydrogen bond donors, and 16 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101232196 is sourced from PubChem (CID 101232196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).