About 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid
5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid (PubChem CID 101232530) has the molecular formula C16H8O8
and a molecular weight of 328.23 g/mol. Its IUPAC name is 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid |
| PubChem CID | 101232530 |
| Molecular Formula | C16H8O8 |
| Molecular Weight | 328.23 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid |
| SMILES | O=C(O)c1cc(Oc2ccc3c(c2)C(=O)OC3=O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C16H8O8/c17-13(18)7-3-8(14(19)20)5-10(4-7)23-9-1-2-11-12(6-9)16(22)24-15(11)21/h1-6H,(H,17,18)(H,19,20) |
| InChIKey | SOFVVDIANSKLGZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.23 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid?
The IUPAC name of 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid (CID 101232530) is 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid.
What is the SMILES notation for 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid?
The canonical SMILES for 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid is O=C(O)c1cc(Oc2ccc3c(c2)C(=O)OC3=O)cc(C(=O)O)c1.
What is the InChIKey of 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid?
The InChIKey is SOFVVDIANSKLGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8O8/c17-13(18)7-3-8(14(19)20)5-10(4-7)23-9-1-2-11-12(6-9)16(22)24-15(11)21/h1-6H,(H,17,18)(H,19,20).
What are the key properties of 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid?
5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid has a molecular weight of 328.23 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1,3-dioxo-2-benzofuran-5-yl)oxy]benzene-1,3-dicarboxylic acid is sourced from PubChem (CID 101232530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).