C11H19BO3 — CID 101232654
2-[(1E,3E)-4-methoxybuta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 101232654) has the molecular formula C11H19BO3 and a molecular weight of 210.08 g/mol. Its IUPAC name is 2-[(1E,3E)-4-methoxybuta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E,3E)-4-methoxybuta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101232654 |
| Molecular Formula | C11H19BO3 |
| Molecular Weight | 210.08 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 2-[(1E,3E)-4-methoxybuta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CO/C=C/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C11H19BO3/c1-10(2)11(3,4)15-12(14-10)8-6-7-9-13-5/h6-9H,1-5H3/b8-6+,9-7+ |
| InChIKey | LGPWAELPCVUCFX-CDJQDVQCSA-N |
| XLogP | 2.33 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.08 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|