C27H24O5S — CID 101232752
(4aR,6S,7R,8R,8aR)-2-anthracen-9-yl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 101232752) has the molecular formula C27H24O5S and a molecular weight of 460.55 g/mol. Its IUPAC name is (4aR,6S,7R,8R,8aR)-2-anthracen-9-yl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6S,7R,8R,8aR)-2-anthracen-9-yl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 101232752 |
| Molecular Formula | C27H24O5S |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (4aR,6S,7R,8R,8aR)-2-anthracen-9-yl-6-phenylsulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](Sc2ccccc2)O[C@@H]2COC(c3c4ccccc4cc4ccccc34)O[C@H]12 |
| InChI | InChI=1S/C27H24O5S/c28-23-24(29)27(33-18-10-2-1-3-11-18)31-21-15-30-26(32-25(21)23)22-19-12-6-4-8-16(19)14-17-9-5-7-13-20(17)22/h1-14,21,23-29H,15H2/t21-,23-,24-,25+,26?,27+/m1/s1 |
| InChIKey | RSRKUKYMGVQTFQ-HLQQYQTDSA-N |
| XLogP | 4.65 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|