C26H34Si2 — CID 101233389
di(cyclopenta-1,4-dien-1-yl)-[4-[di(cyclopenta-1,4-dien-1-yl)-methylsilyl]butyl]-methylsilane (PubChem CID 101233389) has the molecular formula C26H34Si2 and a molecular weight of 402.73 g/mol. Its IUPAC name is di(cyclopenta-1,4-dien-1-yl)-[4-[di(cyclopenta-1,4-dien-1-yl)-methylsilyl]butyl]-methylsilane.
| Compound Name | di(cyclopenta-1,4-dien-1-yl)-[4-[di(cyclopenta-1,4-dien-1-yl)-methylsilyl]butyl]-methylsilane |
|---|---|
| PubChem CID | 101233389 |
| Molecular Formula | C26H34Si2 |
| Molecular Weight | 402.73 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | di(cyclopenta-1,4-dien-1-yl)-[4-[di(cyclopenta-1,4-dien-1-yl)-methylsilyl]butyl]-methylsilane |
| SMILES | C[Si](CCCC[Si](C)(C1=CCC=C1)C1=CCC=C1)(C1=CCC=C1)C1=CCC=C1 |
| InChI | InChI=1S/C26H34Si2/c1-27(23-13-3-4-14-23,24-15-5-6-16-24)21-11-12-22-28(2,25-17-7-8-18-25)26-19-9-10-20-26/h3,5,7,9,13-20H,4,6,8,10-12,21-22H2,1-2H3 |
| InChIKey | BXZMSXAXLJSKPM-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.73 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|