C16H27N5O — CID 101233493
(2S,6R)-12-amino-11-(hexylamino)-9-methyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-7,11-dien-10-one (PubChem CID 101233493) has the molecular formula C16H27N5O and a molecular weight of 305.43 g/mol. Its IUPAC name is (2S,6R)-12-amino-11-(hexylamino)-9-methyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-7,11-dien-10-one.
| Compound Name | (2S,6R)-12-amino-11-(hexylamino)-9-methyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-7,11-dien-10-one |
|---|---|
| PubChem CID | 101233493 |
| Molecular Formula | C16H27N5O |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | (2S,6R)-12-amino-11-(hexylamino)-9-methyl-1,7,9-triazatricyclo[6.4.0.02,6]dodeca-7,11-dien-10-one |
| SMILES | CCCCCCNC1=C(N)N2C(=N[C@@H]3CCC[C@@H]32)N(C)C1=O |
| InChI | InChI=1S/C16H27N5O/c1-3-4-5-6-10-18-13-14(17)21-12-9-7-8-11(12)19-16(21)20(2)15(13)22/h11-12,18H,3-10,17H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | RLWGZMBGDKFSCM-NEPJUHHUSA-N |
| XLogP | 1.35 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|