C13H11F2NO4 — CID 101233549
ethyl 3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropanoate (PubChem CID 101233549) has the molecular formula C13H11F2NO4 and a molecular weight of 283.23 g/mol. Its IUPAC name is ethyl 3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropanoate.
| Compound Name | ethyl 3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropanoate |
|---|---|
| PubChem CID | 101233549 |
| Molecular Formula | C13H11F2NO4 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | ethyl 3-(1,3-dioxoisoindol-2-yl)-2,2-difluoropropanoate |
| SMILES | CCOC(=O)C(F)(F)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H11F2NO4/c1-2-20-12(19)13(14,15)7-16-10(17)8-5-3-4-6-9(8)11(16)18/h3-6H,2,7H2,1H3 |
| InChIKey | MITCADIRDTYSCK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|