C8H11NO4 — CID 101233675
(1R,3R,4S,5R)-2-azabicyclo[2.2.1]heptane-3,5-dicarboxylic acid (PubChem CID 101233675) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is (1R,3R,4S,5R)-2-azabicyclo[2.2.1]heptane-3,5-dicarboxylic acid.
| Compound Name | (1R,3R,4S,5R)-2-azabicyclo[2.2.1]heptane-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 101233675 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (1R,3R,4S,5R)-2-azabicyclo[2.2.1]heptane-3,5-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H]2C[C@@H]1[C@H](C(=O)O)N2 |
| InChI | InChI=1S/C8H11NO4/c10-7(11)5-2-3-1-4(5)6(9-3)8(12)13/h3-6,9H,1-2H2,(H,10,11)(H,12,13)/t3-,4+,5-,6-/m1/s1 |
| InChIKey | NLXPBTDXNHRYAS-JGWLITMVSA-N |
| XLogP | -0.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |