C13H9F9O6S — CID 101233722
methyl 2-methoxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate (PubChem CID 101233722) has the molecular formula C13H9F9O6S and a molecular weight of 464.26 g/mol. Its IUPAC name is methyl 2-methoxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate.
| Compound Name | methyl 2-methoxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 101233722 |
| Molecular Formula | C13H9F9O6S |
| Molecular Weight | 464.26 g/mol |
| Exact Mass | 464.00 |
| IUPAC Name | methyl 2-methoxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyloxy)benzoate |
| SMILES | COC(=O)c1c(OC)cccc1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F9O6S/c1-26-6-4-3-5-7(8(6)9(23)27-2)28-29(24,25)13(21,22)11(16,17)10(14,15)12(18,19)20/h3-5H,1-2H3 |
| InChIKey | SLFFYWPTBAEHFV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|