C13H13NO3 — CID 101234159
(1R,2S)-1-naphthalen-2-yl-2-nitropropan-1-ol (PubChem CID 101234159) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (1R,2S)-1-naphthalen-2-yl-2-nitropropan-1-ol.
| Compound Name | (1R,2S)-1-naphthalen-2-yl-2-nitropropan-1-ol |
|---|---|
| PubChem CID | 101234159 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (1R,2S)-1-naphthalen-2-yl-2-nitropropan-1-ol |
| SMILES | C[C@@H]([C@H](O)c1ccc2ccccc2c1)[N+](=O)[O-] |
| InChI | InChI=1S/C13H13NO3/c1-9(14(16)17)13(15)12-7-6-10-4-2-3-5-11(10)8-12/h2-9,13,15H,1H3/t9-,13-/m0/s1 |
| InChIKey | BFVMKYQBXPESCB-ZANVPECISA-N |
| XLogP | 2.54 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|