C15H21NO7 — CID 101234280
(1S,2S,4S,5R)-4-nitro-5-(2,3,4-trimethoxyphenyl)cyclohexane-1,2-diol (PubChem CID 101234280) has the molecular formula C15H21NO7 and a molecular weight of 327.33 g/mol. Its IUPAC name is (1S,2S,4S,5R)-4-nitro-5-(2,3,4-trimethoxyphenyl)cyclohexane-1,2-diol.
| Compound Name | (1S,2S,4S,5R)-4-nitro-5-(2,3,4-trimethoxyphenyl)cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 101234280 |
| Molecular Formula | C15H21NO7 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (1S,2S,4S,5R)-4-nitro-5-(2,3,4-trimethoxyphenyl)cyclohexane-1,2-diol |
| SMILES | COc1ccc([C@H]2C[C@H](O)[C@@H](O)C[C@@H]2[N+](=O)[O-])c(OC)c1OC |
| InChI | InChI=1S/C15H21NO7/c1-21-13-5-4-8(14(22-2)15(13)23-3)9-6-11(17)12(18)7-10(9)16(19)20/h4-5,9-12,17-18H,6-7H2,1-3H3/t9-,10+,11+,12+/m1/s1 |
| InChIKey | NAEOSISCAZZSFZ-RHYQMDGZSA-N |
| XLogP | 0.96 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|