C23H25NO6 — CID 101234350
(3S,4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxyazetidin-2-one (PubChem CID 101234350) has the molecular formula C23H25NO6 and a molecular weight of 411.45 g/mol. Its IUPAC name is (3S,4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxyazetidin-2-one.
| Compound Name | (3S,4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxyazetidin-2-one |
|---|---|
| PubChem CID | 101234350 |
| Molecular Formula | C23H25NO6 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (3S,4R)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-phenoxyazetidin-2-one |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3NC(=O)[C@H]3Oc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C23H25NO6/c1-23(2)29-20-19(26-13-14-9-5-3-6-10-14)17(28-22(20)30-23)16-18(21(25)24-16)27-15-11-7-4-8-12-15/h3-12,16-20,22H,13H2,1-2H3,(H,24,25)/t16-,17-,18+,19+,20-,22-/m1/s1 |
| InChIKey | KXYQLKUVJDJTRD-DOEDBZELSA-N |
| XLogP | 2.39 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |