C10H18O — CID 101234616
2-[2,2,5,5-tetradeuterio-4-(trideuteriomethyl)cyclohex-3-en-1-yl]propan-2-ol (PubChem CID 101234616) has the molecular formula C10H18O and a molecular weight of 161.30 g/mol. Its IUPAC name is 2-[2,2,5,5-tetradeuterio-4-(trideuteriomethyl)cyclohex-3-en-1-yl]propan-2-ol.
| Compound Name | 2-[2,2,5,5-tetradeuterio-4-(trideuteriomethyl)cyclohex-3-en-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 101234616 |
| Molecular Formula | C10H18O |
| Molecular Weight | 161.30 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | 2-[2,2,5,5-tetradeuterio-4-(trideuteriomethyl)cyclohex-3-en-1-yl]propan-2-ol |
| SMILES | [2H]C([2H])([2H])C1=CC([2H])([2H])C(C(C)(C)O)CC1([2H])[2H] |
| InChI | InChI=1S/C10H18O/c1-8-4-6-9(7-5-8)10(2,3)11/h4,9,11H,5-7H2,1-3H3/i1D3,5D2,6D2 |
| InChIKey | WUOACPNHFRMFPN-FJNYTKNASA-N |
| XLogP | 2.50 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|