C42H63ClFNO11 — CID 101234797
[(2R,3S,4S,5R,6R)-6-[(2S)-2-(2-chloro-6-fluorophenyl)-4-oxopiperidin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate (PubChem CID 101234797) has the molecular formula C42H63ClFNO11 and a molecular weight of 812.41 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2S)-2-(2-chloro-6-fluorophenyl)-4-oxopiperidin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2S)-2-(2-chloro-6-fluorophenyl)-4-oxopiperidin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate |
|---|---|
| PubChem CID | 101234797 |
| Molecular Formula | C42H63ClFNO11 |
| Molecular Weight | 812.41 g/mol |
| Exact Mass | 811.41 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2S)-2-(2-chloro-6-fluorophenyl)-4-oxopiperidin-1-yl]-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 8-hydroxy-2,2-dimethyloctanoate |
| SMILES | CC(C)(C)C(=O)O[C@@H]1[C@@H](OC(=O)C(C)(C)C)[C@H](N2CCC(=O)C[C@H]2c2c(F)cccc2Cl)O[C@H](COC(=O)C(C)(C)CCCCCCO)[C@@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C42H63ClFNO11/c1-39(2,3)35(48)54-31-29(24-52-38(51)42(10,11)20-14-12-13-15-22-46)53-34(33(56-37(50)41(7,8)9)32(31)55-36(49)40(4,5)6)45-21-19-25(47)23-28(45)30-26(43)17-16-18-27(30)44/h16-18,28-29,31-34,46H,12-15,19-24H2,1-11H3/t28-,29+,31-,32-,33+,34+/m0/s1 |
| InChIKey | MQOXLFHXXAGWPU-WIEVSHRFSA-N |
| XLogP | 7.30 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.41 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|