C16H22N4O4 — CID 101234827
2,5-diisocyano-1,6-dimorpholin-4-ylhexane-1,6-dione (PubChem CID 101234827) has the molecular formula C16H22N4O4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 2,5-diisocyano-1,6-dimorpholin-4-ylhexane-1,6-dione.
| Compound Name | 2,5-diisocyano-1,6-dimorpholin-4-ylhexane-1,6-dione |
|---|---|
| PubChem CID | 101234827 |
| Molecular Formula | C16H22N4O4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 2,5-diisocyano-1,6-dimorpholin-4-ylhexane-1,6-dione |
| SMILES | [C-]#[N+]C(CCC([N+]#[C-])C(=O)N1CCOCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C16H22N4O4/c1-17-13(15(21)19-5-9-23-10-6-19)3-4-14(18-2)16(22)20-7-11-24-12-8-20/h13-14H,3-12H2 |
| InChIKey | OYABLVKRCOCDOK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 67.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|