C33H45NO6 — CID 101235458
[(1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] (E)-3-phenylprop-2-enoate (PubChem CID 101235458) has the molecular formula C33H45NO6 and a molecular weight of 551.72 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 101235458 |
| Molecular Formula | C33H45NO6 |
| Molecular Weight | 551.72 g/mol |
| Exact Mass | 551.32 |
| IUPAC Name | [(1S,2R,3R,4S,5R,6S,8R,9S,10R,13S,16S,17R)-11-ethyl-8-hydroxy-6,16-dimethoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecan-4-yl] (E)-3-phenylprop-2-enoate |
| SMILES | CCN1C[C@]2(COC)CC[C@H](OC)[C@@]34[C@@H]5C[C@H]6[C@H](OC(=O)/C=C/c7ccccc7)[C@@H]5[C@@](O)(C[C@@H]6OC)[C@@H](C[C@H]23)[C@@H]14 |
| InChI | InChI=1S/C33H45NO6/c1-5-34-18-31(19-37-2)14-13-26(39-4)33-22-15-21-24(38-3)17-32(36,23(30(33)34)16-25(31)33)28(22)29(21)40-27(35)12-11-20-9-7-6-8-10-20/h6-12,21-26,28-30,36H,5,13-19H2,1-4H3/b12-11+/t21-,22-,23+,24+,25-,26+,28-,29+,30-,31+,32-,33-/m1/s1 |
| InChIKey | WLZGQXZRYWLRFN-QPPOKNOFSA-N |
| XLogP | 3.80 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.72 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|