C11H14O5S2 — CID 101235630
(1S,2S,6R,9R)-6-methyl-9-methylsulfonylsulfonyltricyclo[4.3.0.02,9]non-4-en-8-one (PubChem CID 101235630) has the molecular formula C11H14O5S2 and a molecular weight of 290.36 g/mol. Its IUPAC name is (1S,2S,6R,9R)-6-methyl-9-methylsulfonylsulfonyltricyclo[4.3.0.02,9]non-4-en-8-one.
| Compound Name | (1S,2S,6R,9R)-6-methyl-9-methylsulfonylsulfonyltricyclo[4.3.0.02,9]non-4-en-8-one |
|---|---|
| PubChem CID | 101235630 |
| Molecular Formula | C11H14O5S2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | (1S,2S,6R,9R)-6-methyl-9-methylsulfonylsulfonyltricyclo[4.3.0.02,9]non-4-en-8-one |
| SMILES | C[C@@]12C=CC[C@H]3[C@@H]1[C@@]3(S(=O)(=O)S(C)(=O)=O)C(=O)C2 |
| InChI | InChI=1S/C11H14O5S2/c1-10-5-3-4-7-9(10)11(7,8(12)6-10)18(15,16)17(2,13)14/h3,5,7,9H,4,6H2,1-2H3/t7-,9-,10-,11-/m0/s1 |
| InChIKey | DYONCDVRBNMVSW-ASXGKARISA-N |
| XLogP | 0.28 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|