About tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane
tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane (PubChem CID 101235930) has the molecular formula C14H26O2Si
and a molecular weight of 254.45 g/mol. Its IUPAC name is tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane |
| PubChem CID | 101235930 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane |
| SMILES | C=C=C(OC1CCCCO1)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-7-13(17(5,6)14(2,3)4)16-12-10-8-9-11-15-12/h12H,1,8-11H2,2-6H3 |
| InChIKey | BSFFLJNMKUNWFW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane?
The IUPAC name of tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane (CID 101235930) is tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane.
What is the SMILES notation for tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane?
The canonical SMILES for tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane is C=C=C(OC1CCCCO1)[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane?
The InChIKey is BSFFLJNMKUNWFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26O2Si/c1-7-13(17(5,6)14(2,3)4)16-12-10-8-9-11-15-12/h12H,1,8-11H2,2-6H3.
What are the key properties of tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane?
tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane has a molecular weight of 254.45 g/mol, XLogP of 4.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-[1-(oxan-2-yloxy)propa-1,2-dienyl]silane is sourced from PubChem (CID 101235930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).