C21H30O4 — CID 101236207
(2R)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-3,6-dihydro-2H-oxepin-7-one (PubChem CID 101236207) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (2R)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-3,6-dihydro-2H-oxepin-7-one.
| Compound Name | (2R)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-3,6-dihydro-2H-oxepin-7-one |
|---|---|
| PubChem CID | 101236207 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (2R)-2-[(1R,2R)-2-[(1R,2E,4S,6Z,9Z)-1,4-dihydroxydodeca-2,6,9-trienyl]cyclopropyl]-3,6-dihydro-2H-oxepin-7-one |
| SMILES | CC/C=C\C/C=C\C[C@H](O)/C=C/[C@@H](O)[C@@H]1C[C@H]1[C@H]1CC=CCC(=O)O1 |
| InChI | InChI=1S/C21H30O4/c1-2-3-4-5-6-7-10-16(22)13-14-19(23)17-15-18(17)20-11-8-9-12-21(24)25-20/h3-4,6-9,13-14,16-20,22-23H,2,5,10-12,15H2,1H3/b4-3-,7-6-,14-13+/t16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | VGWYTSHGJVDTMZ-VLMVPVBFSA-N |
| XLogP | 3.46 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|