C18H37NO3 — CID 101236554
(E,2S,3R,6R)-2-aminooctadec-4-ene-1,3,6-triol (PubChem CID 101236554) has the molecular formula C18H37NO3 and a molecular weight of 315.50 g/mol. Its IUPAC name is (E,2S,3R,6R)-2-aminooctadec-4-ene-1,3,6-triol.
| Compound Name | (E,2S,3R,6R)-2-aminooctadec-4-ene-1,3,6-triol |
|---|---|
| PubChem CID | 101236554 |
| Molecular Formula | C18H37NO3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.28 |
| IUPAC Name | (E,2S,3R,6R)-2-aminooctadec-4-ene-1,3,6-triol |
| SMILES | CCCCCCCCCCCC[C@@H](O)/C=C/[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C18H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-16(21)13-14-18(22)17(19)15-20/h13-14,16-18,20-22H,2-12,15,19H2,1H3/b14-13+/t16-,17+,18-/m1/s1 |
| InChIKey | LUZYTSCABOWJAC-FUXYQIOVSA-N |
| XLogP | 2.89 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|