C26H36N4 — CID 101236708
N-propan-2-yl-7-[(1R,2R)-2-[[2-(propan-2-ylamino)cyclohepta-2,4,6-trien-1-ylidene]amino]cyclohexyl]iminocyclohepta-1,3,5-trien-1-amine (PubChem CID 101236708) has the molecular formula C26H36N4 and a molecular weight of 404.60 g/mol. Its IUPAC name is N-propan-2-yl-7-[(1R,2R)-2-[[2-(propan-2-ylamino)cyclohepta-2,4,6-trien-1-ylidene]amino]cyclohexyl]iminocyclohepta-1,3,5-trien-1-amine.
| Compound Name | N-propan-2-yl-7-[(1R,2R)-2-[[2-(propan-2-ylamino)cyclohepta-2,4,6-trien-1-ylidene]amino]cyclohexyl]iminocyclohepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 101236708 |
| Molecular Formula | C26H36N4 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | N-propan-2-yl-7-[(1R,2R)-2-[[2-(propan-2-ylamino)cyclohepta-2,4,6-trien-1-ylidene]amino]cyclohexyl]iminocyclohepta-1,3,5-trien-1-amine |
| SMILES | CC(C)Nc1ccccc/c1=N\[C@@H]1CCCC[C@H]1/N=c1\cccccc1NC(C)C |
| InChI | InChI=1S/C26H36N4/c1-19(2)27-21-13-7-5-9-15-23(21)29-25-17-11-12-18-26(25)30-24-16-10-6-8-14-22(24)28-20(3)4/h5-10,13-16,19-20,25-26H,11-12,17-18H2,1-4H3,(H,27,29)(H,28,30)/t25-,26-/m1/s1 |
| InChIKey | GYKIQCDMPXIDJH-CLJLJLNGSA-N |
| XLogP | 5.14 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |