About (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate
(4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate (PubChem CID 101237182) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate.
Molecular Properties
| Compound Name | (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate |
| PubChem CID | 101237182 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC1=CCC(C)(C)CC1=O |
| InChI | InChI=1S/C12H16O3/c1-4-5-11(14)15-10-6-7-12(2,3)8-9(10)13/h4-6H,7-8H2,1-3H3/b5-4+ |
| InChIKey | PGULTZMHQZDDKF-SNAWJCMRSA-N |
| XLogP | 2.38 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate?
The IUPAC name of (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate (CID 101237182) is (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate.
What is the SMILES notation for (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate?
The canonical SMILES for (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate is C/C=C/C(=O)OC1=CCC(C)(C)CC1=O.
What is the InChIKey of (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate?
The InChIKey is PGULTZMHQZDDKF-SNAWJCMRSA-N. The full InChI is InChI=1S/C12H16O3/c1-4-5-11(14)15-10-6-7-12(2,3)8-9(10)13/h4-6H,7-8H2,1-3H3/b5-4+.
What are the key properties of (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate?
(4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate has a molecular weight of 208.26 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-6-oxocyclohexen-1-yl) (E)-but-2-enoate is sourced from PubChem (CID 101237182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).