C15H20N2O8S — CID 101237235
(1R)-1-[(3aS,4S,6aR)-2,2-dimethyl-5-(4-nitrophenyl)sulfonyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol (PubChem CID 101237235) has the molecular formula C15H20N2O8S and a molecular weight of 388.40 g/mol. Its IUPAC name is (1R)-1-[(3aS,4S,6aR)-2,2-dimethyl-5-(4-nitrophenyl)sulfonyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(3aS,4S,6aR)-2,2-dimethyl-5-(4-nitrophenyl)sulfonyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 101237235 |
| Molecular Formula | C15H20N2O8S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | (1R)-1-[(3aS,4S,6aR)-2,2-dimethyl-5-(4-nitrophenyl)sulfonyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrol-4-yl]ethane-1,2-diol |
| SMILES | CC1(C)O[C@H]2[C@H]([C@@H](O)CO)N(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C[C@H]2O1 |
| InChI | InChI=1S/C15H20N2O8S/c1-15(2)24-12-7-16(13(11(19)8-18)14(12)25-15)26(22,23)10-5-3-9(4-6-10)17(20)21/h3-6,11-14,18-19H,7-8H2,1-2H3/t11-,12+,13-,14+/m0/s1 |
| InChIKey | YNTCTNULOYQOAE-RFQIPJPRSA-N |
| XLogP | -0.16 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|