C11H24O3S — CID 101237270
(2R,3R,4S)-1-tert-butylsulfinyl-3-methylhexane-2,4-diol (PubChem CID 101237270) has the molecular formula C11H24O3S and a molecular weight of 236.38 g/mol. Its IUPAC name is (2R,3R,4S)-1-tert-butylsulfinyl-3-methylhexane-2,4-diol.
| Compound Name | (2R,3R,4S)-1-tert-butylsulfinyl-3-methylhexane-2,4-diol |
|---|---|
| PubChem CID | 101237270 |
| Molecular Formula | C11H24O3S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (2R,3R,4S)-1-tert-butylsulfinyl-3-methylhexane-2,4-diol |
| SMILES | CC[C@H](O)[C@@H](C)[C@@H](O)CS(=O)C(C)(C)C |
| InChI | InChI=1S/C11H24O3S/c1-6-9(12)8(2)10(13)7-15(14)11(3,4)5/h8-10,12-13H,6-7H2,1-5H3/t8-,9+,10+,15?/m1/s1 |
| InChIKey | XEYDBOGJVVKCPN-HZFPGNGNSA-N |
| XLogP | 1.30 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |