C20H28O4Si — CID 101237474
methyl (4aS,5S,8aR)-5-[dimethyl(phenyl)silyl]-1-hydroxy-7-oxo-1,2,3,4,5,6,8,8a-octahydronaphthalene-4a-carboxylate (PubChem CID 101237474) has the molecular formula C20H28O4Si and a molecular weight of 360.53 g/mol. Its IUPAC name is methyl (4aS,5S,8aR)-5-[dimethyl(phenyl)silyl]-1-hydroxy-7-oxo-1,2,3,4,5,6,8,8a-octahydronaphthalene-4a-carboxylate.
| Compound Name | methyl (4aS,5S,8aR)-5-[dimethyl(phenyl)silyl]-1-hydroxy-7-oxo-1,2,3,4,5,6,8,8a-octahydronaphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 101237474 |
| Molecular Formula | C20H28O4Si |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | methyl (4aS,5S,8aR)-5-[dimethyl(phenyl)silyl]-1-hydroxy-7-oxo-1,2,3,4,5,6,8,8a-octahydronaphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCCC(O)[C@@H]1CC(=O)C[C@@H]2[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C20H28O4Si/c1-24-19(23)20-11-7-10-17(22)16(20)12-14(21)13-18(20)25(2,3)15-8-5-4-6-9-15/h4-6,8-9,16-18,22H,7,10-13H2,1-3H3/t16-,17?,18-,20+/m0/s1 |
| InChIKey | JZLZMELLGDTVHY-FXCQJFQISA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|