C9H16O2 — CID 101237658
(2R,3R)-3-hexyloxirane-2-carbaldehyde (PubChem CID 101237658) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is (2R,3R)-3-hexyloxirane-2-carbaldehyde.
| Compound Name | (2R,3R)-3-hexyloxirane-2-carbaldehyde |
|---|---|
| PubChem CID | 101237658 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (2R,3R)-3-hexyloxirane-2-carbaldehyde |
| SMILES | CCCCCC[C@H]1O[C@H]1C=O |
| InChI | InChI=1S/C9H16O2/c1-2-3-4-5-6-8-9(7-10)11-8/h7-9H,2-6H2,1H3/t8-,9+/m1/s1 |
| InChIKey | CXWONQXFWHZHPN-BDAKNGLRSA-N |
| XLogP | 1.92 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|