About (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran
(2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran (PubChem CID 101238409) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran.
Molecular Properties
| Compound Name | (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran |
| PubChem CID | 101238409 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran |
| SMILES | CO[C@@H]1OC=C[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-12-11-10(7-8-13-11)9-5-3-2-4-6-9/h2-8,10-11H,1H3/t10-,11-/m1/s1 |
| InChIKey | CRPNAGLPOROMHA-GHMZBOCLSA-N |
| XLogP | 2.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran?
The IUPAC name of (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran (CID 101238409) is (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran.
What is the SMILES notation for (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran?
The canonical SMILES for (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran is CO[C@@H]1OC=C[C@@H]1c1ccccc1.
What is the InChIKey of (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran?
The InChIKey is CRPNAGLPOROMHA-GHMZBOCLSA-N. The full InChI is InChI=1S/C11H12O2/c1-12-11-10(7-8-13-11)9-5-3-2-4-6-9/h2-8,10-11H,1H3/t10-,11-/m1/s1.
What are the key properties of (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran?
(2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran has a molecular weight of 176.22 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-2-methoxy-3-phenyl-2,3-dihydrofuran is sourced from PubChem (CID 101238409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).