C14H22O5Si — CID 101238502
(1R,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 101238502) has the molecular formula C14H22O5Si and a molecular weight of 298.41 g/mol. Its IUPAC name is (1R,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | (1R,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 101238502 |
| Molecular Formula | C14H22O5Si |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1R,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(CO)C(=O)[C@H]2O[C@H]2C1=O |
| InChI | InChI=1S/C14H22O5Si/c1-14(2,3)20(4,5)18-7-9-8(6-15)10(16)12-13(19-12)11(9)17/h12-13,15H,6-7H2,1-5H3/t12-,13+/m1/s1 |
| InChIKey | TYNOOBZOZZGBOJ-OLZOCXBDSA-N |
| XLogP | 1.22 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|