C14H24O5Si — CID 101238503
(1R,5S,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 101238503) has the molecular formula C14H24O5Si and a molecular weight of 300.43 g/mol. Its IUPAC name is (1R,5S,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1R,5S,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 101238503 |
| Molecular Formula | C14H24O5Si |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (1R,5S,6S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-hydroxy-4-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C(CO)[C@H](O)[C@@H]2O[C@H]2C1=O |
| InChI | InChI=1S/C14H24O5Si/c1-14(2,3)20(4,5)18-7-9-8(6-15)10(16)12-13(19-12)11(9)17/h10,12-13,15-16H,6-7H2,1-5H3/t10-,12-,13-/m0/s1 |
| InChIKey | RMCDYWMYUHEHLL-DRZSPHRISA-N |
| XLogP | 1.01 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|