About tin(2+);bis(2,4,6-tris(dimethylamino)phenolate)
tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) (PubChem CID 101238546) has the molecular formula C24H40N6O2Sn
and a molecular weight of 563.34 g/mol. Its IUPAC name is tin(2+);bis(2,4,6-tris(dimethylamino)phenolate).
Molecular Properties
| Compound Name | tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) |
| PubChem CID | 101238546 |
| Molecular Formula | C24H40N6O2Sn |
| Molecular Weight | 563.34 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) |
| SMILES | CN(C)c1cc(N(C)C)c([O-])c(N(C)C)c1.CN(C)c1cc(N(C)C)c([O-])c(N(C)C)c1.[Sn+2] |
| InChI | InChI=1S/2C12H21N3O.Sn/c2*1-13(2)9-7-10(14(3)4)12(16)11(8-9)15(5)6;/h2*7-8,16H,1-6H3;/q;;+2/p-2 |
| InChIKey | PTWVTWCRERWUSU-UHFFFAOYSA-L |
| XLogP | 1.54 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 563.34 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tin(2+);bis(2,4,6-tris(dimethylamino)phenolate)?
The IUPAC name of tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) (CID 101238546) is tin(2+);bis(2,4,6-tris(dimethylamino)phenolate).
What is the SMILES notation for tin(2+);bis(2,4,6-tris(dimethylamino)phenolate)?
The canonical SMILES for tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) is CN(C)c1cc(N(C)C)c([O-])c(N(C)C)c1.CN(C)c1cc(N(C)C)c([O-])c(N(C)C)c1.[Sn+2].
What is the InChIKey of tin(2+);bis(2,4,6-tris(dimethylamino)phenolate)?
The InChIKey is PTWVTWCRERWUSU-UHFFFAOYSA-L. The full InChI is InChI=1S/2C12H21N3O.Sn/c2*1-13(2)9-7-10(14(3)4)12(16)11(8-9)15(5)6;/h2*7-8,16H,1-6H3;/q;;+2/p-2.
What are the key properties of tin(2+);bis(2,4,6-tris(dimethylamino)phenolate)?
tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) has a molecular weight of 563.34 g/mol, XLogP of 1.54, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for tin(2+);bis(2,4,6-tris(dimethylamino)phenolate) is sourced from PubChem (CID 101238546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).