About 1-oxaspiro[4.5]deca-6,8-diene
1-oxaspiro[4.5]deca-6,8-diene (PubChem CID 101238617) has the molecular formula C9H12O
and a molecular weight of 136.19 g/mol. Its IUPAC name is 1-oxaspiro[4.5]deca-6,8-diene.
Molecular Properties
| Compound Name | 1-oxaspiro[4.5]deca-6,8-diene |
| PubChem CID | 101238617 |
| Molecular Formula | C9H12O |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.09 |
| IUPAC Name | 1-oxaspiro[4.5]deca-6,8-diene |
| SMILES | C1=CCC2(C=C1)CCCO2 |
| InChI | InChI=1S/C9H12O/c1-2-5-9(6-3-1)7-4-8-10-9/h1-3,5H,4,6-8H2 |
| InChIKey | SXCXQQGEOCLYPS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-oxaspiro[4.5]deca-6,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxaspiro[4.5]deca-6,8-diene?
The IUPAC name of 1-oxaspiro[4.5]deca-6,8-diene (CID 101238617) is 1-oxaspiro[4.5]deca-6,8-diene.
What is the SMILES notation for 1-oxaspiro[4.5]deca-6,8-diene?
The canonical SMILES for 1-oxaspiro[4.5]deca-6,8-diene is C1=CCC2(C=C1)CCCO2.
What is the InChIKey of 1-oxaspiro[4.5]deca-6,8-diene?
The InChIKey is SXCXQQGEOCLYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O/c1-2-5-9(6-3-1)7-4-8-10-9/h1-3,5H,4,6-8H2.
What are the key properties of 1-oxaspiro[4.5]deca-6,8-diene?
1-oxaspiro[4.5]deca-6,8-diene has a molecular weight of 136.19 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxaspiro[4.5]deca-6,8-diene is sourced from PubChem (CID 101238617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).