C11H10KN3S — CID 101238747
potassium 2,2-dicyano-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethenethiolate (PubChem CID 101238747) has the molecular formula C11H10KN3S and a molecular weight of 255.39 g/mol. Its IUPAC name is potassium 2,2-dicyano-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethenethiolate.
| Compound Name | potassium 2,2-dicyano-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethenethiolate |
|---|---|
| PubChem CID | 101238747 |
| Molecular Formula | C11H10KN3S |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | potassium 2,2-dicyano-1-(2,4,5-trimethyl-1H-pyrrol-3-yl)ethenethiolate |
| SMILES | Cc1[nH]c(C)c(C([S-])=C(C#N)C#N)c1C.[K+] |
| InChI | InChI=1S/C11H11N3S.K/c1-6-7(2)14-8(3)10(6)11(15)9(4-12)5-13;/h14-15H,1-3H3;/q;+1/p-1 |
| InChIKey | ZYLRSURHAZGLEF-UHFFFAOYSA-M |
| XLogP | -0.75 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|