C8H11N5O — CID 101239641
3a,4,6,7,8,10a-hexahydro-1H-pyrimido[1,2-a]purin-10-one (PubChem CID 101239641) has the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. Its IUPAC name is 3a,4,6,7,8,10a-hexahydro-1H-pyrimido[1,2-a]purin-10-one.
| Compound Name | 3a,4,6,7,8,10a-hexahydro-1H-pyrimido[1,2-a]purin-10-one |
|---|---|
| PubChem CID | 101239641 |
| Molecular Formula | C8H11N5O |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 3a,4,6,7,8,10a-hexahydro-1H-pyrimido[1,2-a]purin-10-one |
| SMILES | O=C1C2NC=NC2NC2=NCCCN12 |
| InChI | InChI=1S/C8H11N5O/c14-7-5-6(11-4-10-5)12-8-9-2-1-3-13(7)8/h4-6H,1-3H2,(H,9,12)(H,10,11) |
| InChIKey | AUDSEGQYWRCTPU-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |