C35H52O2S4Si — CID 101239842
1-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-dithian-2-yl]-3-(2-butyl-1,3-dithian-2-yl)propan-2-one (PubChem CID 101239842) has the molecular formula C35H52O2S4Si and a molecular weight of 661.15 g/mol. Its IUPAC name is 1-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-dithian-2-yl]-3-(2-butyl-1,3-dithian-2-yl)propan-2-one.
| Compound Name | 1-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-dithian-2-yl]-3-(2-butyl-1,3-dithian-2-yl)propan-2-one |
|---|---|
| PubChem CID | 101239842 |
| Molecular Formula | C35H52O2S4Si |
| Molecular Weight | 661.15 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 1-[2-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-1,3-dithian-2-yl]-3-(2-butyl-1,3-dithian-2-yl)propan-2-one |
| SMILES | CCCCC1(CC(=O)CC2(CCCCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)SCCCS2)SCCCS1 |
| InChI | InChI=1S/C35H52O2S4Si/c1-5-6-21-34(38-24-15-25-39-34)28-30(36)29-35(40-26-16-27-41-35)22-13-14-23-37-42(33(2,3)4,31-17-9-7-10-18-31)32-19-11-8-12-20-32/h7-12,17-20H,5-6,13-16,21-29H2,1-4H3 |
| InChIKey | IKLCDFZSLYGKJM-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.15 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|