C18H17NO3 — CID 101240007
(4S)-3-[(2R,3R)-3-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 101240007) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is (4S)-3-[(2R,3R)-3-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-3-[(2R,3R)-3-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101240007 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | (4S)-3-[(2R,3R)-3-methyl-3-phenyloxiran-2-yl]-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C[C@]1(c2ccccc2)O[C@H]1N1C(=O)OC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H17NO3/c1-18(14-10-6-3-7-11-14)16(22-18)19-15(12-21-17(19)20)13-8-4-2-5-9-13/h2-11,15-16H,12H2,1H3/t15-,16-,18-/m1/s1 |
| InChIKey | HEUBQIWFKXFFTM-JFIYKMOQSA-N |
| XLogP | 3.45 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|