C25H31N3O — CID 101240821
2-[3-[(E)-2-[4-(6-hydroxyhexylamino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile (PubChem CID 101240821) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-[3-[(E)-2-[4-(6-hydroxyhexylamino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile.
| Compound Name | 2-[3-[(E)-2-[4-(6-hydroxyhexylamino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 101240821 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 2-[3-[(E)-2-[4-(6-hydroxyhexylamino)phenyl]ethenyl]-5,5-dimethylcyclohex-2-en-1-ylidene]propanedinitrile |
| SMILES | CC1(C)CC(/C=C/c2ccc(NCCCCCCO)cc2)=CC(=C(C#N)C#N)C1 |
| InChI | InChI=1S/C25H31N3O/c1-25(2)16-21(15-22(17-25)23(18-26)19-27)8-7-20-9-11-24(12-10-20)28-13-5-3-4-6-14-29/h7-12,15,28-29H,3-6,13-14,16-17H2,1-2H3/b8-7+ |
| InChIKey | VKKZCMNBHXEHFR-BQYQJAHWSA-N |
| XLogP | 5.75 |
| TPSA | 79.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|