C14H22N4O8 — CID 101240963
2-[[2-[[7-[[2-(carboxyamino)-2-oxoethyl]amino]-7-oxoheptanoyl]amino]acetyl]amino]acetic acid (PubChem CID 101240963) has the molecular formula C14H22N4O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is 2-[[2-[[7-[[2-(carboxyamino)-2-oxoethyl]amino]-7-oxoheptanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[7-[[2-(carboxyamino)-2-oxoethyl]amino]-7-oxoheptanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 101240963 |
| Molecular Formula | C14H22N4O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[[2-[[7-[[2-(carboxyamino)-2-oxoethyl]amino]-7-oxoheptanoyl]amino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CCCCCC(=O)NCC(=O)NC(=O)O |
| InChI | InChI=1S/C14H22N4O8/c19-9(15-6-11(21)17-8-13(23)24)4-2-1-3-5-10(20)16-7-12(22)18-14(25)26/h1-8H2,(H,15,19)(H,16,20)(H,17,21)(H,18,22)(H,23,24)(H,25,26) |
| InChIKey | HMZNORYCCNWJMG-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|