C12H22O3 — CID 101241335
(1S,2R,5R,6S)-2-ethyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol (PubChem CID 101241335) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is (1S,2R,5R,6S)-2-ethyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol.
| Compound Name | (1S,2R,5R,6S)-2-ethyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol |
|---|---|
| PubChem CID | 101241335 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (1S,2R,5R,6S)-2-ethyl-5,6-bis(methoxymethyl)cyclohex-3-en-1-ol |
| SMILES | CC[C@@H]1C=C[C@@H](COC)[C@@H](COC)[C@H]1O |
| InChI | InChI=1S/C12H22O3/c1-4-9-5-6-10(7-14-2)11(8-15-3)12(9)13/h5-6,9-13H,4,7-8H2,1-3H3/t9-,10+,11-,12+/m1/s1 |
| InChIKey | FAPCAMVNNRNBCP-KXNHARMFSA-N |
| XLogP | 1.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|