C37H13F15MnN4O6S2+3 — CID 10124167
manganese(3+);5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-13,21,22,24-tetrahydro-12H-corrin-2,17-disulfonic acid (PubChem CID 10124167) has the molecular formula C37H13F15MnN4O6S2+3 and a molecular weight of 1013.57 g/mol. Its IUPAC name is manganese(3+);5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-13,21,22,24-tetrahydro-12H-corrin-2,17-disulfonic acid.
| Compound Name | manganese(3+);5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-13,21,22,24-tetrahydro-12H-corrin-2,17-disulfonic acid |
|---|---|
| PubChem CID | 10124167 |
| Molecular Formula | C37H13F15MnN4O6S2+3 |
| Molecular Weight | 1013.57 g/mol |
| Exact Mass | 1012.94 |
| IUPAC Name | manganese(3+);5,10,15-tris(2,3,4,5,6-pentafluorophenyl)-13,21,22,24-tetrahydro-12H-corrin-2,17-disulfonic acid |
| SMILES | O=S(=O)(O)c1cc2[nH]c1c(-c1c(F)c(F)c(F)c(F)c1F)c1nc(c(-c3c(F)c(F)c(F)c(F)c3F)c3ccc([nH]3)c(-c3c(F)c(F)c(F)c(F)c3F)c3cc(S(=O)(=O)O)c2[nH]3)CC1.[Mn+3] |
| InChI | InChI=1S/C37H13F15N4O6S2.Mn/c38-21-18(22(39)28(45)33(50)27(21)44)15-7-1-2-9(53-7)16(19-23(40)29(46)34(51)30(47)24(19)41)11-5-13(63(57,58)59)36(55-11)12-6-14(64(60,61)62)37(56-12)17(10-4-3-8(15)54-10)20-25(42)31(48)35(52)32(49)26(20)43;/h1-2,5-6,53,55-56H,3-4H2,(H,57,58,59)(H,60,61,62);/q;+3/b15-7+,15-8+,16-9+,16-11+,17-10-,36-12-,37-17+; |
| InChIKey | XKJFDBXXBLAFPZ-QDWXPRJESA-N |
| XLogP | 9.89 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.57 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|