C21H26F12O2Si2 — CID 101241741
[1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-trimethylsilyloxypropan-2-yl)-5-prop-2-enylphenyl]propan-2-yl]oxy-trimethylsilane (PubChem CID 101241741) has the molecular formula C21H26F12O2Si2 and a molecular weight of 594.59 g/mol. Its IUPAC name is [1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-trimethylsilyloxypropan-2-yl)-5-prop-2-enylphenyl]propan-2-yl]oxy-trimethylsilane.
| Compound Name | [1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-trimethylsilyloxypropan-2-yl)-5-prop-2-enylphenyl]propan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101241741 |
| Molecular Formula | C21H26F12O2Si2 |
| Molecular Weight | 594.59 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | [1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-trimethylsilyloxypropan-2-yl)-5-prop-2-enylphenyl]propan-2-yl]oxy-trimethylsilane |
| SMILES | C=CCc1cc(C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)cc(C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C21H26F12O2Si2/c1-8-9-13-10-14(16(18(22,23)24,19(25,26)27)34-36(2,3)4)12-15(11-13)17(20(28,29)30,21(31,32)33)35-37(5,6)7/h8,10-12H,1,9H2,2-7H3 |
| InChIKey | NMOMEDMXJVGWQE-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.59 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|