C14H20O — CID 101241761
(1S,2R,6R)-2,9-dimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one (PubChem CID 101241761) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is (1S,2R,6R)-2,9-dimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one.
| Compound Name | (1S,2R,6R)-2,9-dimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one |
|---|---|
| PubChem CID | 101241761 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (1S,2R,6R)-2,9-dimethyltricyclo[4.3.3.01,6]dodec-8-en-7-one |
| SMILES | CC1=CC(=O)[C@@]23CCC[C@@H](C)[C@@]12CCC3 |
| InChI | InChI=1S/C14H20O/c1-10-5-3-6-13-7-4-8-14(10,13)11(2)9-12(13)15/h9-10H,3-8H2,1-2H3/t10-,13+,14+/m1/s1 |
| InChIKey | CLXVPDRDFDEJNT-SWHYSGLUSA-N |
| XLogP | 3.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |