About 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one
2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one (PubChem CID 101241954) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one.
Molecular Properties
| Compound Name | 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one |
| PubChem CID | 101241954 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one |
| SMILES | CC[C@H](C)[C@H](O)C1=C(C)C(O)OC1=O |
| InChI | InChI=1S/C10H16O4/c1-4-5(2)8(11)7-6(3)9(12)14-10(7)13/h5,8-9,11-12H,4H2,1-3H3/t5-,8-,9?/m0/s1 |
| InChIKey | VRTCJUXPNAIHPP-RFRSVTRVSA-N |
| XLogP | 0.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one?
The IUPAC name of 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one (CID 101241954) is 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one.
What is the SMILES notation for 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one?
The canonical SMILES for 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one is CC[C@H](C)[C@H](O)C1=C(C)C(O)OC1=O.
What is the InChIKey of 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one?
The InChIKey is VRTCJUXPNAIHPP-RFRSVTRVSA-N. The full InChI is InChI=1S/C10H16O4/c1-4-5(2)8(11)7-6(3)9(12)14-10(7)13/h5,8-9,11-12H,4H2,1-3H3/t5-,8-,9?/m0/s1.
What are the key properties of 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one?
2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one has a molecular weight of 200.23 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-[(1S,2S)-1-hydroxy-2-methylbutyl]-3-methyl-2H-furan-5-one is sourced from PubChem (CID 101241954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).