C28H37NO2 — CID 101242018
tert-butyl (2S,3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-methyl-2-prop-2-enylpent-4-enoate (PubChem CID 101242018) has the molecular formula C28H37NO2 and a molecular weight of 419.61 g/mol. Its IUPAC name is tert-butyl (2S,3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-methyl-2-prop-2-enylpent-4-enoate.
| Compound Name | tert-butyl (2S,3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-methyl-2-prop-2-enylpent-4-enoate |
|---|---|
| PubChem CID | 101242018 |
| Molecular Formula | C28H37NO2 |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | tert-butyl (2S,3R)-3-[benzyl-[(1S)-1-phenylethyl]amino]-4-methyl-2-prop-2-enylpent-4-enoate |
| SMILES | C=CC[C@H](C(=O)OC(C)(C)C)[C@H](C(=C)C)N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C28H37NO2/c1-8-15-25(27(30)31-28(5,6)7)26(21(2)3)29(20-23-16-11-9-12-17-23)22(4)24-18-13-10-14-19-24/h8-14,16-19,22,25-26H,1-2,15,20H2,3-7H3/t22-,25-,26-/m0/s1 |
| InChIKey | JNMBMKRWNGPIKF-HRNNMHKYSA-N |
| XLogP | 6.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|