C15H16O2 — CID 101242054
(1R,8S,10R)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one (PubChem CID 101242054) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (1R,8S,10R)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one.
| Compound Name | (1R,8S,10R)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
|---|---|
| PubChem CID | 101242054 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1R,8S,10R)-16-oxatetracyclo[6.6.2.01,10.02,7]hexadeca-2,4,6-trien-15-one |
| SMILES | O=C1O[C@H]2C[C@H]3CCCC[C@@]13c1ccccc12 |
| InChI | InChI=1S/C15H16O2/c16-14-15-8-4-3-5-10(15)9-13(17-14)11-6-1-2-7-12(11)15/h1-2,6-7,10,13H,3-5,8-9H2/t10-,13+,15-/m1/s1 |
| InChIKey | HSOIVCSIMYJDSU-RIEGTJTDSA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |